About N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine
N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine (PubChem CID 146198396) has the molecular formula C23H26ClN3
and a molecular weight of 379.94 g/mol. Its IUPAC name is N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine.
Molecular Properties
| Compound Name | N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine |
| PubChem CID | 146198396 |
| Molecular Formula | C23H26ClN3 |
| Molecular Weight | 379.94 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine |
| SMILES | CC(C)N(CCCCCl)c1cnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H26ClN3/c1-18(2)27(16-10-9-15-24)21-17-25-22(19-11-5-3-6-12-19)23(26-21)20-13-7-4-8-14-20/h3-8,11-14,17-18H,9-10,15-16H2,1-2H3 |
| InChIKey | NCUUIJGXJPAKBJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.94 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine?
The IUPAC name of N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine (CID 146198396) is N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine.
What is the SMILES notation for N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine?
The canonical SMILES for N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine is CC(C)N(CCCCCl)c1cnc(-c2ccccc2)c(-c2ccccc2)n1.
What is the InChIKey of N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine?
The InChIKey is NCUUIJGXJPAKBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26ClN3/c1-18(2)27(16-10-9-15-24)21-17-25-22(19-11-5-3-6-12-19)23(26-21)20-13-7-4-8-14-20/h3-8,11-14,17-18H,9-10,15-16H2,1-2H3.
What are the key properties of N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine?
N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine has a molecular weight of 379.94 g/mol, XLogP of 6.04, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorobutyl)-5,6-diphenyl-N-propan-2-ylpyrazin-2-amine is sourced from PubChem (CID 146198396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).