About 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine
6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine (PubChem CID 146198872) has the molecular formula C8H9ClN4O2
and a molecular weight of 228.64 g/mol. Its IUPAC name is 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine |
| PubChem CID | 146198872 |
| Molecular Formula | C8H9ClN4O2 |
| Molecular Weight | 228.64 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine |
| SMILES | CCCCOc1nc2nonc2nc1Cl |
| InChI | InChI=1S/C8H9ClN4O2/c1-2-3-4-14-8-5(9)10-6-7(11-8)13-15-12-6/h2-4H2,1H3 |
| InChIKey | GESWPXVFJWOVQK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.64 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine?
The IUPAC name of 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine (CID 146198872) is 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine.
What is the SMILES notation for 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine?
The canonical SMILES for 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine is CCCCOc1nc2nonc2nc1Cl.
What is the InChIKey of 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine?
The InChIKey is GESWPXVFJWOVQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN4O2/c1-2-3-4-14-8-5(9)10-6-7(11-8)13-15-12-6/h2-4H2,1H3.
What are the key properties of 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine?
6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine has a molecular weight of 228.64 g/mol, XLogP of 1.85, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butoxy-5-chloro-[1,2,5]oxadiazolo[3,4-b]pyrazine is sourced from PubChem (CID 146198872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).