About 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine
5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine (PubChem CID 146198908) has the molecular formula C7H7ClN4O2
and a molecular weight of 214.61 g/mol. Its IUPAC name is 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine |
| PubChem CID | 146198908 |
| Molecular Formula | C7H7ClN4O2 |
| Molecular Weight | 214.61 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine |
| SMILES | CC(C)Oc1nc2nonc2nc1Cl |
| InChI | InChI=1S/C7H7ClN4O2/c1-3(2)13-7-4(8)9-5-6(10-7)12-14-11-5/h3H,1-2H3 |
| InChIKey | YCFRTADSFFPMST-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.61 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine?
The IUPAC name of 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine (CID 146198908) is 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine.
What is the SMILES notation for 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine?
The canonical SMILES for 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine is CC(C)Oc1nc2nonc2nc1Cl.
What is the InChIKey of 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine?
The InChIKey is YCFRTADSFFPMST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN4O2/c1-3(2)13-7-4(8)9-5-6(10-7)12-14-11-5/h3H,1-2H3.
What are the key properties of 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine?
5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine has a molecular weight of 214.61 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-propan-2-yloxy-[1,2,5]oxadiazolo[3,4-b]pyrazine is sourced from PubChem (CID 146198908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).