C25H28F3N9O4S — CID 146199349
(2E,4Z)-6-[[2-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-4-methyl-7-oxo-8-[(2S)-1,1,1-trifluoropropan-2-yl]pteridin-6-yl]amino]-5-(methylideneamino)hexa-2,4-diene-2-sulfonamide (PubChem CID 146199349) has the molecular formula C25H28F3N9O4S and a molecular weight of 607.62 g/mol. Its IUPAC name is (2E,4Z)-6-[[2-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-4-methyl-7-oxo-8-[(2S)-1,1,1-trifluoropropan-2-yl]pteridin-6-yl]amino]-5-(methylideneamino)hexa-2,4-diene-2-sulfonamide.
| Compound Name | (2E,4Z)-6-[[2-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-4-methyl-7-oxo-8-[(2S)-1,1,1-trifluoropropan-2-yl]pteridin-6-yl]amino]-5-(methylideneamino)hexa-2,4-diene-2-sulfonamide |
|---|---|
| PubChem CID | 146199349 |
| Molecular Formula | C25H28F3N9O4S |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | (2E,4Z)-6-[[2-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-4-methyl-7-oxo-8-[(2S)-1,1,1-trifluoropropan-2-yl]pteridin-6-yl]amino]-5-(methylideneamino)hexa-2,4-diene-2-sulfonamide |
| SMILES | C=N/C(=C\C=C(/C)S(N)(=O)=O)CNc1nc2c(C)nc(-c3c(OC)ncnc3C3CC3)nc2n([C@@H](C)C(F)(F)F)c1=O |
| InChI | InChI=1S/C25H28F3N9O4S/c1-12(42(29,39)40)6-9-16(30-4)10-31-21-24(38)37(14(3)25(26,27)28)22-18(35-21)13(2)34-20(36-22)17-19(15-7-8-15)32-11-33-23(17)41-5/h6,9,11,14-15H,4,7-8,10H2,1-3,5H3,(H,31,35)(H2,29,39,40)/b12-6+,16-9-/t14-/m0/s1 |
| InChIKey | SBDUKYXTEPCZOZ-BMFRMFGSSA-N |
| XLogP | 3.15 |
| TPSA | 180.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|