C33H38F2N2O — CID 146200106
4-tert-butyl-N-[3-fluoro-5-[(3-fluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]benzamide (PubChem CID 146200106) has the molecular formula C33H38F2N2O and a molecular weight of 516.68 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-fluoro-5-[(3-fluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-fluoro-5-[(3-fluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]benzamide |
|---|---|
| PubChem CID | 146200106 |
| Molecular Formula | C33H38F2N2O |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 4-tert-butyl-N-[3-fluoro-5-[(3-fluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cc3c(cc2F)C(Nc2cc4c(cc2F)CCCCC4)CCCC3)cc1 |
| InChI | InChI=1S/C33H38F2N2O/c1-33(2,3)25-15-13-21(14-16-25)32(38)37-31-19-24-11-7-8-12-29(26(24)20-28(31)35)36-30-18-23-10-6-4-5-9-22(23)17-27(30)34/h13-20,29,36H,4-12H2,1-3H3,(H,37,38) |
| InChIKey | OWRBBCQZKSFJCY-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |