About (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine
(Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine (PubChem CID 146200231) has the molecular formula C10H20FN
and a molecular weight of 173.27 g/mol. Its IUPAC name is (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine.
Molecular Properties
| Compound Name | (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine |
| PubChem CID | 146200231 |
| Molecular Formula | C10H20FN |
| Molecular Weight | 173.27 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine |
| SMILES | C/C=C\C(C(C)C)N(C)C(C)F |
| InChI | InChI=1S/C10H20FN/c1-6-7-10(8(2)3)12(5)9(4)11/h6-10H,1-5H3/b7-6- |
| InChIKey | MDSSOPOMPGIKJH-SREVYHEPSA-N |
| XLogP | 2.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine?
The IUPAC name of (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine (CID 146200231) is (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine.
What is the SMILES notation for (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine?
The canonical SMILES for (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine is C/C=C\C(C(C)C)N(C)C(C)F.
What is the InChIKey of (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine?
The InChIKey is MDSSOPOMPGIKJH-SREVYHEPSA-N. The full InChI is InChI=1S/C10H20FN/c1-6-7-10(8(2)3)12(5)9(4)11/h6-10H,1-5H3/b7-6-.
What are the key properties of (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine?
(Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine has a molecular weight of 173.27 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(1-fluoroethyl)-N,2-dimethylhex-4-en-3-amine is sourced from PubChem (CID 146200231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).