C21H26ClFINO5 — CID 146200917
methyl 7-chloro-2-[4-[3-[fluoro(iodo)methoxy]azetidin-1-yl]cyclohexyl]-2,4-dimethyl-1,3-benzodioxole-5-carboxylate (PubChem CID 146200917) has the molecular formula C21H26ClFINO5 and a molecular weight of 553.80 g/mol. Its IUPAC name is methyl 7-chloro-2-[4-[3-[fluoro(iodo)methoxy]azetidin-1-yl]cyclohexyl]-2,4-dimethyl-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl 7-chloro-2-[4-[3-[fluoro(iodo)methoxy]azetidin-1-yl]cyclohexyl]-2,4-dimethyl-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 146200917 |
| Molecular Formula | C21H26ClFINO5 |
| Molecular Weight | 553.80 g/mol |
| Exact Mass | 553.05 |
| IUPAC Name | methyl 7-chloro-2-[4-[3-[fluoro(iodo)methoxy]azetidin-1-yl]cyclohexyl]-2,4-dimethyl-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c2c(c1C)OC(C)(C1CCC(N3CC(OC(F)I)C3)CC1)O2 |
| InChI | InChI=1S/C21H26ClFINO5/c1-11-15(19(26)27-3)8-16(22)18-17(11)29-21(2,30-18)12-4-6-13(7-5-12)25-9-14(10-25)28-20(23)24/h8,12-14,20H,4-7,9-10H2,1-3H3 |
| InChIKey | STSTXCQLTCUNHB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.80 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|