About (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one
(1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one (PubChem CID 146200989) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one.
Molecular Properties
| Compound Name | (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one |
| PubChem CID | 146200989 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one |
| SMILES | CC(C)N1/N=C\CCCCCC1=O |
| InChI | InChI=1S/C10H18N2O/c1-9(2)12-10(13)7-5-3-4-6-8-11-12/h8-9H,3-7H2,1-2H3/b11-8- |
| InChIKey | OVTDITRHQKXGEL-FLIBITNWSA-N |
| XLogP | 2.17 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one?
The IUPAC name of (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one (CID 146200989) is (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one.
What is the SMILES notation for (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one?
The canonical SMILES for (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one is CC(C)N1/N=C\CCCCCC1=O.
What is the InChIKey of (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one?
The InChIKey is OVTDITRHQKXGEL-FLIBITNWSA-N. The full InChI is InChI=1S/C10H18N2O/c1-9(2)12-10(13)7-5-3-4-6-8-11-12/h8-9H,3-7H2,1-2H3/b11-8-.
What are the key properties of (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one?
(1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one has a molecular weight of 182.27 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-2-propan-2-yl-5,6,7,8-tetrahydro-4H-diazonin-3-one is sourced from PubChem (CID 146200989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).