C33H34N2O6 — CID 146201205
3'-methylidene-1-[9-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)nonyl]spiro[indole-3,5'-oxolane]-2,2'-dione (PubChem CID 146201205) has the molecular formula C33H34N2O6 and a molecular weight of 554.64 g/mol. Its IUPAC name is 3'-methylidene-1-[9-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)nonyl]spiro[indole-3,5'-oxolane]-2,2'-dione.
| Compound Name | 3'-methylidene-1-[9-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)nonyl]spiro[indole-3,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 146201205 |
| Molecular Formula | C33H34N2O6 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 3'-methylidene-1-[9-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)nonyl]spiro[indole-3,5'-oxolane]-2,2'-dione |
| SMILES | C=C1CC2(OC1=O)C(=O)N(CCCCCCCCCN1C(=O)C3(CC(=C)C(=O)O3)c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C33H34N2O6/c1-22-20-32(40-28(22)36)24-14-8-10-16-26(24)34(30(32)38)18-12-6-4-3-5-7-13-19-35-27-17-11-9-15-25(27)33(31(35)39)21-23(2)29(37)41-33/h8-11,14-17H,1-7,12-13,18-21H2 |
| InChIKey | SDCRWKKQIZMOHJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|