C29H26N2O6 — CID 146201217
3'-methylidene-1-[5-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)pentyl]spiro[indole-3,5'-oxolane]-2,2'-dione (PubChem CID 146201217) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is 3'-methylidene-1-[5-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)pentyl]spiro[indole-3,5'-oxolane]-2,2'-dione.
| Compound Name | 3'-methylidene-1-[5-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)pentyl]spiro[indole-3,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 146201217 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 3'-methylidene-1-[5-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)pentyl]spiro[indole-3,5'-oxolane]-2,2'-dione |
| SMILES | C=C1CC2(OC1=O)C(=O)N(CCCCCN1C(=O)C3(CC(=C)C(=O)O3)c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C29H26N2O6/c1-18-16-28(36-24(18)32)20-10-4-6-12-22(20)30(26(28)34)14-8-3-9-15-31-23-13-7-5-11-21(23)29(27(31)35)17-19(2)25(33)37-29/h4-7,10-13H,1-3,8-9,14-17H2 |
| InChIKey | WYFPDGPLUWKUEP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|