About spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate
spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 146201303) has the molecular formula C18H22O4
and a molecular weight of 302.37 g/mol. Its IUPAC name is spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 146201303 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCC1=CC2CC1C1(COCO1)C2)C1CC2C=CC1C2 |
| InChI | InChI=1S/C18H22O4/c19-17(15-5-11-1-2-13(15)3-11)21-8-14-4-12-6-16(14)18(7-12)9-20-10-22-18/h1-2,4,11-13,15-16H,3,5-10H2 |
| InChIKey | DUKFRWOEVSIROO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 146201303) is spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate is O=C(OCC1=CC2CC1C1(COCO1)C2)C1CC2C=CC1C2.
What is the InChIKey of spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is DUKFRWOEVSIROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O4/c19-17(15-5-11-1-2-13(15)3-11)21-8-14-4-12-6-16(14)18(7-12)9-20-10-22-18/h1-2,4,11-13,15-16H,3,5-10H2.
What are the key properties of spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 302.37 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-4,6'-bicyclo[2.2.1]hept-2-ene]-2'-ylmethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 146201303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).