C21H29N7O — CID 146202313
(7S)-2-[[1-[[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-4-yl]methylamino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one (PubChem CID 146202313) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is (7S)-2-[[1-[[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-4-yl]methylamino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one.
| Compound Name | (7S)-2-[[1-[[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-4-yl]methylamino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 146202313 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | (7S)-2-[[1-[[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-4-yl]methylamino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one |
| SMILES | Cc1nc(NCc2cnn(C[C@@H]3C[C@@H]4CC[C@H]3C4)c2)nc2c1NC(=O)[C@H](C)N2C |
| InChI | InChI=1S/C21H29N7O/c1-12-18-19(27(3)13(2)20(29)25-18)26-21(24-12)22-8-15-9-23-28(10-15)11-17-7-14-4-5-16(17)6-14/h9-10,13-14,16-17H,4-8,11H2,1-3H3,(H,25,29)(H,22,24,26)/t13-,14+,16-,17-/m0/s1 |
| InChIKey | AHBGMDZRCHMKNU-FSDCSDTHSA-N |
| XLogP | 2.81 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |