C21H21F3N6O — CID 146202588
(2S)-1,2,5-trimethyl-7-[[1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one (PubChem CID 146202588) has the molecular formula C21H21F3N6O and a molecular weight of 430.43 g/mol. Its IUPAC name is (2S)-1,2,5-trimethyl-7-[[1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one.
| Compound Name | (2S)-1,2,5-trimethyl-7-[[1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 146202588 |
| Molecular Formula | C21H21F3N6O |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (2S)-1,2,5-trimethyl-7-[[1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one |
| SMILES | Cc1nc(NCc2cnn(Cc3ccc(F)c(F)c3F)c2)cc2c1NC(=O)[C@H](C)N2C |
| InChI | InChI=1S/C21H21F3N6O/c1-11-20-16(29(3)12(2)21(31)28-20)6-17(27-11)25-7-13-8-26-30(9-13)10-14-4-5-15(22)19(24)18(14)23/h4-6,8-9,12H,7,10H2,1-3H3,(H,25,27)(H,28,31)/t12-/m0/s1 |
| InChIKey | SOOCLEDGEROBBW-LBPRGKRZSA-N |
| XLogP | 3.44 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|