C20H21F3N8OS2 — CID 146203263
(7S)-2-[[bis(sulfanyl)-[1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazol-4-yl]methyl]amino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one (PubChem CID 146203263) has the molecular formula C20H21F3N8OS2 and a molecular weight of 510.57 g/mol. Its IUPAC name is (7S)-2-[[bis(sulfanyl)-[1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazol-4-yl]methyl]amino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one.
| Compound Name | (7S)-2-[[bis(sulfanyl)-[1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazol-4-yl]methyl]amino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 146203263 |
| Molecular Formula | C20H21F3N8OS2 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | (7S)-2-[[bis(sulfanyl)-[1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazol-4-yl]methyl]amino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one |
| SMILES | Cc1nc(NC(S)(S)c2cnn(Cc3ccc(C(F)(F)F)nc3)c2)nc2c1NC(=O)[C@H](C)N2C |
| InChI | InChI=1S/C20H21F3N8OS2/c1-10-15-16(30(3)11(2)17(32)27-15)28-18(26-10)29-20(33,34)13-7-25-31(9-13)8-12-4-5-14(24-6-12)19(21,22)23/h4-7,9,11,33-34H,8H2,1-3H3,(H,27,32)(H,26,28,29)/t11-/m0/s1 |
| InChIKey | WBHSDCQNMUHJIG-NSHDSACASA-N |
| XLogP | 3.30 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|