C24H24FN5O3 — CID 146203456
(6aS,8R)-2-[[4-[(4-fluorophenyl)methoxy]phenyl]methylamino]-8-hydroxy-4-methyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one (PubChem CID 146203456) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is (6aS,8R)-2-[[4-[(4-fluorophenyl)methoxy]phenyl]methylamino]-8-hydroxy-4-methyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one.
| Compound Name | (6aS,8R)-2-[[4-[(4-fluorophenyl)methoxy]phenyl]methylamino]-8-hydroxy-4-methyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 146203456 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (6aS,8R)-2-[[4-[(4-fluorophenyl)methoxy]phenyl]methylamino]-8-hydroxy-4-methyl-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one |
| SMILES | Cc1nc(NCc2ccc(OCc3ccc(F)cc3)cc2)nc2c1NC(=O)[C@@H]1C[C@@H](O)CN21 |
| InChI | InChI=1S/C24H24FN5O3/c1-14-21-22(30-12-18(31)10-20(30)23(32)28-21)29-24(27-14)26-11-15-4-8-19(9-5-15)33-13-16-2-6-17(25)7-3-16/h2-9,18,20,31H,10-13H2,1H3,(H,28,32)(H,26,27,29)/t18-,20+/m1/s1 |
| InChIKey | KLJJGRNFCSQGBS-QUCCMNQESA-N |
| XLogP | 3.01 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |