C24H22F3N5O3 — CID 146203671
(6aS,8R)-8-hydroxy-4-methyl-2-[[4-[(3,4,5-trifluorophenyl)methoxy]phenyl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one (PubChem CID 146203671) has the molecular formula C24H22F3N5O3 and a molecular weight of 485.47 g/mol. Its IUPAC name is (6aS,8R)-8-hydroxy-4-methyl-2-[[4-[(3,4,5-trifluorophenyl)methoxy]phenyl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one.
| Compound Name | (6aS,8R)-8-hydroxy-4-methyl-2-[[4-[(3,4,5-trifluorophenyl)methoxy]phenyl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 146203671 |
| Molecular Formula | C24H22F3N5O3 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | (6aS,8R)-8-hydroxy-4-methyl-2-[[4-[(3,4,5-trifluorophenyl)methoxy]phenyl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one |
| SMILES | Cc1nc(NCc2ccc(OCc3cc(F)c(F)c(F)c3)cc2)nc2c1NC(=O)[C@@H]1C[C@@H](O)CN21 |
| InChI | InChI=1S/C24H22F3N5O3/c1-12-21-22(32-10-15(33)8-19(32)23(34)30-21)31-24(29-12)28-9-13-2-4-16(5-3-13)35-11-14-6-17(25)20(27)18(26)7-14/h2-7,15,19,33H,8-11H2,1H3,(H,30,34)(H,28,29,31)/t15-,19+/m1/s1 |
| InChIKey | VHXDBKAFCUEVFC-BEFAXECRSA-N |
| XLogP | 3.29 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|