C22H35FN2 — CID 146204446
(3Z,5E)-6-N-ethyl-6-N-[(2S,3E,7R)-3-ethylidene-7-methylnon-8-yn-2-yl]-7-fluoroocta-3,5,7-triene-1,6-diamine (PubChem CID 146204446) has the molecular formula C22H35FN2 and a molecular weight of 346.53 g/mol. Its IUPAC name is (3Z,5E)-6-N-ethyl-6-N-[(2S,3E,7R)-3-ethylidene-7-methylnon-8-yn-2-yl]-7-fluoroocta-3,5,7-triene-1,6-diamine.
| Compound Name | (3Z,5E)-6-N-ethyl-6-N-[(2S,3E,7R)-3-ethylidene-7-methylnon-8-yn-2-yl]-7-fluoroocta-3,5,7-triene-1,6-diamine |
|---|---|
| PubChem CID | 146204446 |
| Molecular Formula | C22H35FN2 |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.28 |
| IUPAC Name | (3Z,5E)-6-N-ethyl-6-N-[(2S,3E,7R)-3-ethylidene-7-methylnon-8-yn-2-yl]-7-fluoroocta-3,5,7-triene-1,6-diamine |
| SMILES | C#C[C@H](C)CCC/C(=C\C)[C@H](C)N(CC)/C(=C/C=C\CCN)C(=C)F |
| InChI | InChI=1S/C22H35FN2/c1-7-18(4)14-13-15-21(8-2)20(6)25(9-3)22(19(5)23)16-11-10-12-17-24/h1,8,10-11,16,18,20H,5,9,12-15,17,24H2,2-4,6H3/b11-10-,21-8+,22-16+/t18-,20-/m0/s1 |
| InChIKey | ZNKOPSUDCUHCBK-BJGSLTDQSA-N |
| XLogP | 5.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|