C12H9N9 — CID 146205407
[1,3-bis(dicyanomethyl)-1,3-diazinan-5-yl]-cyanocyanamide (PubChem CID 146205407) has the molecular formula C12H9N9 and a molecular weight of 279.27 g/mol. Its IUPAC name is [1,3-bis(dicyanomethyl)-1,3-diazinan-5-yl]-cyanocyanamide.
| Compound Name | [1,3-bis(dicyanomethyl)-1,3-diazinan-5-yl]-cyanocyanamide |
|---|---|
| PubChem CID | 146205407 |
| Molecular Formula | C12H9N9 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [1,3-bis(dicyanomethyl)-1,3-diazinan-5-yl]-cyanocyanamide |
| SMILES | N#CC(C#N)N1CC(N(C#N)C#N)CN(C(C#N)C#N)C1 |
| InChI | InChI=1S/C12H9N9/c13-1-10(2-14)19-5-12(21(7-17)8-18)6-20(9-19)11(3-15)4-16/h10-12H,5-6,9H2 |
| InChIKey | ZCASMZNGGCOQGU-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 152.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|