C17H24N4O8 — CID 14620659
4-[[4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methoxy]-4-oxobutanoic acid (PubChem CID 14620659) has the molecular formula C17H24N4O8 and a molecular weight of 412.40 g/mol. Its IUPAC name is 4-[[4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 14620659 |
| Molecular Formula | C17H24N4O8 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-[[4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methoxy]-4-oxobutanoic acid |
| SMILES | CC(C(C)N1CC(=O)N(COC(=O)CCC(=O)O)C(=O)C1)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C17H24N4O8/c1-10(19-5-12(22)18-13(23)6-19)11(2)20-7-14(24)21(15(25)8-20)9-29-17(28)4-3-16(26)27/h10-11H,3-9H2,1-2H3,(H,26,27)(H,18,22,23) |
| InChIKey | SWUMZLOXPSAYIC-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|