C19H25Cl — CID 146207470
1-chloro-3-[(3E,5Z)-8-cyclopentylocta-3,5-dien-3-yl]benzene (PubChem CID 146207470) has the molecular formula C19H25Cl and a molecular weight of 288.86 g/mol. Its IUPAC name is 1-chloro-3-[(3E,5Z)-8-cyclopentylocta-3,5-dien-3-yl]benzene.
| Compound Name | 1-chloro-3-[(3E,5Z)-8-cyclopentylocta-3,5-dien-3-yl]benzene |
|---|---|
| PubChem CID | 146207470 |
| Molecular Formula | C19H25Cl |
| Molecular Weight | 288.86 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-chloro-3-[(3E,5Z)-8-cyclopentylocta-3,5-dien-3-yl]benzene |
| SMILES | CC/C(=C\C=C/CCC1CCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H25Cl/c1-2-17(18-13-8-14-19(20)15-18)12-5-3-4-9-16-10-6-7-11-16/h3,5,8,12-16H,2,4,6-7,9-11H2,1H3/b5-3-,17-12+ |
| InChIKey | YGYHLUAOHJXQEJ-KHDLQPLDSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.86 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|