C16H18N2O — CID 146207479
3-(5-amino-2-methylphenyl)-N,N-dimethylbenzamide (PubChem CID 146207479) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-(5-amino-2-methylphenyl)-N,N-dimethylbenzamide.
| Compound Name | 3-(5-amino-2-methylphenyl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 146207479 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-(5-amino-2-methylphenyl)-N,N-dimethylbenzamide |
| SMILES | Cc1ccc(N)cc1-c1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H18N2O/c1-11-7-8-14(17)10-15(11)12-5-4-6-13(9-12)16(19)18(2)3/h4-10H,17H2,1-3H3 |
| InChIKey | BJWIVDPYXRMDHS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|