C21H38N2 — CID 146207872
3-ethyl-5,6-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]-3-[2-(propan-2-ylideneamino)ethyl]hept-6-en-1-amine (PubChem CID 146207872) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]-3-[2-(propan-2-ylideneamino)ethyl]hept-6-en-1-amine.
| Compound Name | 3-ethyl-5,6-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]-3-[2-(propan-2-ylideneamino)ethyl]hept-6-en-1-amine |
|---|---|
| PubChem CID | 146207872 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | 3-ethyl-5,6-dimethyl-N-[(1E)-3-methylbuta-1,3-dienyl]-3-[2-(propan-2-ylideneamino)ethyl]hept-6-en-1-amine |
| SMILES | C=C(C)/C=C/NCCC(CC)(CCN=C(C)C)CC(C)C(=C)C |
| InChI | InChI=1S/C21H38N2/c1-9-21(12-15-23-19(6)7,16-20(8)18(4)5)11-14-22-13-10-17(2)3/h10,13,20,22H,2,4,9,11-12,14-16H2,1,3,5-8H3/b13-10+ |
| InChIKey | FAIAFCWFXHPVIZ-JLHYYAGUSA-N |
| XLogP | 5.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|