C17H24O7 — CID 146208532
dimethyl (3aR,6aS)-5',5'-dimethyl-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1,3-dicarboxylate (PubChem CID 146208532) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is dimethyl (3aR,6aS)-5',5'-dimethyl-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1,3-dicarboxylate.
| Compound Name | dimethyl (3aR,6aS)-5',5'-dimethyl-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1,3-dicarboxylate |
|---|---|
| PubChem CID | 146208532 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | dimethyl (3aR,6aS)-5',5'-dimethyl-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1,3-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)[C@@H]2CC3(C[C@H]12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C17H24O7/c1-16(2)7-23-17(24-8-16)5-9-10(6-17)12(15(20)22-4)13(18)11(9)14(19)21-3/h9-12H,5-8H2,1-4H3/t9-,10+,11?,12? |
| InChIKey | GIRFOKNYRLSCFA-ZYANWLCNSA-N |
| XLogP | 0.94 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|