C17H26O6 — CID 146208557
methyl (3'aR,6'aS)-2'-acetyloxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate (PubChem CID 146208557) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is methyl (3'aR,6'aS)-2'-acetyloxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate.
| Compound Name | methyl (3'aR,6'aS)-2'-acetyloxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate |
|---|---|
| PubChem CID | 146208557 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | methyl (3'aR,6'aS)-2'-acetyloxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate |
| SMILES | COC(=O)C1C(OC(C)=O)C[C@@H]2CC3(C[C@H]12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C17H26O6/c1-10(18)23-13-5-11-6-17(21-8-16(2,3)9-22-17)7-12(11)14(13)15(19)20-4/h11-14H,5-9H2,1-4H3/t11-,12+,13?,14?/m1/s1 |
| InChIKey | LDKSIMRNUKXQHL-KBHBFKLGSA-N |
| XLogP | 1.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |