About (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid
(Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid (PubChem CID 146208631) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid |
| PubChem CID | 146208631 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid |
| SMILES | C/C=C\C(C)(ONc1cc(C)cc(C)c1)C(=O)O |
| InChI | InChI=1S/C14H19NO3/c1-5-6-14(4,13(16)17)18-15-12-8-10(2)7-11(3)9-12/h5-9,15H,1-4H3,(H,16,17)/b6-5- |
| InChIKey | XIOUERVGPGLRJK-WAYWQWQTSA-N |
| XLogP | 3.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid?
The IUPAC name of (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid (CID 146208631) is (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid.
What is the SMILES notation for (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid?
The canonical SMILES for (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid is C/C=C\C(C)(ONc1cc(C)cc(C)c1)C(=O)O.
What is the InChIKey of (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid?
The InChIKey is XIOUERVGPGLRJK-WAYWQWQTSA-N. The full InChI is InChI=1S/C14H19NO3/c1-5-6-14(4,13(16)17)18-15-12-8-10(2)7-11(3)9-12/h5-9,15H,1-4H3,(H,16,17)/b6-5-.
What are the key properties of (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid?
(Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid has a molecular weight of 249.31 g/mol, XLogP of 3.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(3,5-dimethylanilino)oxy-2-methylpent-3-enoic acid is sourced from PubChem (CID 146208631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).