C25H35F2N5O4 — CID 146208940
(2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbonylamino)piperidin-1-yl]butanoic acid (PubChem CID 146208940) has the molecular formula C25H35F2N5O4 and a molecular weight of 507.58 g/mol. Its IUPAC name is (2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbonylamino)piperidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbonylamino)piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 146208940 |
| Molecular Formula | C25H35F2N5O4 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | (2S)-2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbonylamino)piperidin-1-yl]butanoic acid |
| SMILES | O=C(NC1CCN(CC[C@H](NC(=O)C2CCC(F)(F)CC2)C(=O)O)CC1)c1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C25H35F2N5O4/c26-25(27)10-5-17(6-11-25)22(33)31-20(24(35)36)9-15-32-13-7-18(8-14-32)29-23(34)19-4-3-16-2-1-12-28-21(16)30-19/h3-4,17-18,20H,1-2,5-15H2,(H,28,30)(H,29,34)(H,31,33)(H,35,36)/t20-/m0/s1 |
| InChIKey | ZUYAPAMZKVQNGG-FQEVSTJZSA-N |
| XLogP | 2.42 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |