About N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide
N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide (PubChem CID 146209056) has the molecular formula C22H17F2N3O2
and a molecular weight of 393.39 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide.
Molecular Properties
| Compound Name | N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide |
| PubChem CID | 146209056 |
| Molecular Formula | C22H17F2N3O2 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide |
| SMILES | O=C(NC(CO)c1cc(F)ccc1F)c1cccc(-c2ccc3[nH]ncc3c2)c1 |
| InChI | InChI=1S/C22H17F2N3O2/c23-17-5-6-19(24)18(10-17)21(12-28)26-22(29)15-3-1-2-13(8-15)14-4-7-20-16(9-14)11-25-27-20/h1-11,21,28H,12H2,(H,25,27)(H,26,29) |
| InChIKey | ILVOKNGCZRZTJJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide?
The IUPAC name of N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide (CID 146209056) is N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide.
What is the SMILES notation for N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide?
The canonical SMILES for N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide is O=C(NC(CO)c1cc(F)ccc1F)c1cccc(-c2ccc3[nH]ncc3c2)c1.
What is the InChIKey of N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide?
The InChIKey is ILVOKNGCZRZTJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F2N3O2/c23-17-5-6-19(24)18(10-17)21(12-28)26-22(29)15-3-1-2-13(8-15)14-4-7-20-16(9-14)11-25-27-20/h1-11,21,28H,12H2,(H,25,27)(H,26,29).
What are the key properties of N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide?
N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide has a molecular weight of 393.39 g/mol, XLogP of 3.97, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,5-difluorophenyl)-2-hydroxyethyl]-3-(1H-indazol-5-yl)benzamide is sourced from PubChem (CID 146209056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).