C26H32F2N4O3 — CID 146209178
(2S)-2-benzamido-4-[3,3-difluoro-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]piperidin-1-yl]butanoic acid (PubChem CID 146209178) has the molecular formula C26H32F2N4O3 and a molecular weight of 486.56 g/mol. Its IUPAC name is (2S)-2-benzamido-4-[3,3-difluoro-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]piperidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-benzamido-4-[3,3-difluoro-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 146209178 |
| Molecular Formula | C26H32F2N4O3 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (2S)-2-benzamido-4-[3,3-difluoro-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]piperidin-1-yl]butanoic acid |
| SMILES | O=C(N[C@@H](CCN1CC(CCc2ccc3c(n2)NCCC3)CC(F)(F)C1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C26H32F2N4O3/c27-26(28)15-18(8-10-21-11-9-19-7-4-13-29-23(19)30-21)16-32(17-26)14-12-22(25(34)35)31-24(33)20-5-2-1-3-6-20/h1-3,5-6,9,11,18,22H,4,7-8,10,12-17H2,(H,29,30)(H,31,33)(H,34,35)/t18?,22-/m0/s1 |
| InChIKey | XUZJDPGVDNHPNV-YSYXNDDBSA-N |
| XLogP | 3.60 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |