C26H33ClN4O3 — CID 146209184
(2S)-2-[[2-(2-chlorophenyl)acetyl]amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid (PubChem CID 146209184) has the molecular formula C26H33ClN4O3 and a molecular weight of 485.03 g/mol. Its IUPAC name is (2S)-2-[[2-(2-chlorophenyl)acetyl]amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-[[2-(2-chlorophenyl)acetyl]amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 146209184 |
| Molecular Formula | C26H33ClN4O3 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (2S)-2-[[2-(2-chlorophenyl)acetyl]amino]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid |
| SMILES | O=C(Cc1ccccc1Cl)N[C@@H](CCN1CC[C@@H](CCc2ccc3c(n2)NCCC3)C1)C(=O)O |
| InChI | InChI=1S/C26H33ClN4O3/c27-22-6-2-1-4-20(22)16-24(32)30-23(26(33)34)12-15-31-14-11-18(17-31)7-9-21-10-8-19-5-3-13-28-25(19)29-21/h1-2,4,6,8,10,18,23H,3,5,7,9,11-17H2,(H,28,29)(H,30,32)(H,33,34)/t18-,23+/m1/s1 |
| InChIKey | DNXDZJUUXZJGOJ-JPYJTQIMSA-N |
| XLogP | 3.55 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |