C28H38N4O4 — CID 146209203
(2S)-2-[(2,2-dimethyl-3-phenylpropanoyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]azetidin-1-yl]butanoic acid (PubChem CID 146209203) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is (2S)-2-[(2,2-dimethyl-3-phenylpropanoyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]azetidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-[(2,2-dimethyl-3-phenylpropanoyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]azetidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 146209203 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | (2S)-2-[(2,2-dimethyl-3-phenylpropanoyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]azetidin-1-yl]butanoic acid |
| SMILES | CC(C)(Cc1ccccc1)C(=O)N[C@@H](CCN1CC(OCCc2ccc3c(n2)NCCC3)C1)C(=O)O |
| InChI | InChI=1S/C28H38N4O4/c1-28(2,17-20-7-4-3-5-8-20)27(35)31-24(26(33)34)12-15-32-18-23(19-32)36-16-13-22-11-10-21-9-6-14-29-25(21)30-22/h3-5,7-8,10-11,23-24H,6,9,12-19H2,1-2H3,(H,29,30)(H,31,35)(H,33,34)/t24-/m0/s1 |
| InChIKey | DNLXPLTUMJPGRM-DEOSSOPVSA-N |
| XLogP | 2.91 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |