C19H28N4O2 — CID 146209267
N-[1-[1-[(2S)-2-amino-1-hydroxypropyl]piperidin-4-yl]ethyl]-1H-indole-3-carboxamide (PubChem CID 146209267) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[1-[1-[(2S)-2-amino-1-hydroxypropyl]piperidin-4-yl]ethyl]-1H-indole-3-carboxamide.
| Compound Name | N-[1-[1-[(2S)-2-amino-1-hydroxypropyl]piperidin-4-yl]ethyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 146209267 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N-[1-[1-[(2S)-2-amino-1-hydroxypropyl]piperidin-4-yl]ethyl]-1H-indole-3-carboxamide |
| SMILES | CC(NC(=O)c1c[nH]c2ccccc12)C1CCN(C(O)[C@H](C)N)CC1 |
| InChI | InChI=1S/C19H28N4O2/c1-12(20)19(25)23-9-7-14(8-10-23)13(2)22-18(24)16-11-21-17-6-4-3-5-15(16)17/h3-6,11-14,19,21,25H,7-10,20H2,1-2H3,(H,22,24)/t12-,13?,19?/m0/s1 |
| InChIKey | AIYZDERIUZYJGH-GLIABKTBSA-N |
| XLogP | 1.66 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |