About N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide
N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide (PubChem CID 146209353) has the molecular formula C10H16FNO2S
and a molecular weight of 233.31 g/mol. Its IUPAC name is N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide |
| PubChem CID | 146209353 |
| Molecular Formula | C10H16FNO2S |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide |
| SMILES | CC1=CC=C(S(=O)(=O)NCCF)CC1C |
| InChI | InChI=1S/C10H16FNO2S/c1-8-3-4-10(7-9(8)2)15(13,14)12-6-5-11/h3-4,9,12H,5-7H2,1-2H3 |
| InChIKey | GVGGZJTWUVWYPD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide?
The IUPAC name of N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide (CID 146209353) is N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide.
What is the SMILES notation for N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide?
The canonical SMILES for N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide is CC1=CC=C(S(=O)(=O)NCCF)CC1C.
What is the InChIKey of N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide?
The InChIKey is GVGGZJTWUVWYPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16FNO2S/c1-8-3-4-10(7-9(8)2)15(13,14)12-6-5-11/h3-4,9,12H,5-7H2,1-2H3.
What are the key properties of N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide?
N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide has a molecular weight of 233.31 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethyl)-4,5-dimethylcyclohexa-1,3-diene-1-sulfonamide is sourced from PubChem (CID 146209353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).