C14H19N5 — CID 146209357
5-(2-but-1-en-2-ylpyrrolidin-1-yl)pyrazolo[1,5-a]pyrimidin-3-amine (PubChem CID 146209357) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 5-(2-but-1-en-2-ylpyrrolidin-1-yl)pyrazolo[1,5-a]pyrimidin-3-amine.
| Compound Name | 5-(2-but-1-en-2-ylpyrrolidin-1-yl)pyrazolo[1,5-a]pyrimidin-3-amine |
|---|---|
| PubChem CID | 146209357 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 5-(2-but-1-en-2-ylpyrrolidin-1-yl)pyrazolo[1,5-a]pyrimidin-3-amine |
| SMILES | C=C(CC)C1CCCN1c1ccn2ncc(N)c2n1 |
| InChI | InChI=1S/C14H19N5/c1-3-10(2)12-5-4-7-18(12)13-6-8-19-14(17-13)11(15)9-16-19/h6,8-9,12H,2-5,7,15H2,1H3 |
| InChIKey | ABUCPQGLFCPICN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|