About (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol
(7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol (PubChem CID 146209361) has the molecular formula C11H15FO
and a molecular weight of 182.24 g/mol. Its IUPAC name is (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol.
Molecular Properties
| Compound Name | (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol |
| PubChem CID | 146209361 |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol |
| SMILES | C=C/C(F)=C\C(C)CC#CCCO |
| InChI | InChI=1S/C11H15FO/c1-3-11(12)9-10(2)7-5-4-6-8-13/h3,9-10,13H,1,6-8H2,2H3/b11-9+ |
| InChIKey | WKQILVLPJRGLKW-PKNBQFBNSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol?
The IUPAC name of (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol (CID 146209361) is (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol.
What is the SMILES notation for (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol?
The canonical SMILES for (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol is C=C/C(F)=C\C(C)CC#CCCO.
What is the InChIKey of (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol?
The InChIKey is WKQILVLPJRGLKW-PKNBQFBNSA-N. The full InChI is InChI=1S/C11H15FO/c1-3-11(12)9-10(2)7-5-4-6-8-13/h3,9-10,13H,1,6-8H2,2H3/b11-9+.
What are the key properties of (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol?
(7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol has a molecular weight of 182.24 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7E)-8-fluoro-6-methyldeca-7,9-dien-3-yn-1-ol is sourced from PubChem (CID 146209361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).