About [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite
[2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite (PubChem CID 146209464) has the molecular formula C11H17FO2
and a molecular weight of 200.25 g/mol. Its IUPAC name is [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite.
Molecular Properties
| Compound Name | [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite |
| PubChem CID | 146209464 |
| Molecular Formula | C11H17FO2 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite |
| SMILES | C=C1C(COF)CCC1C(C)C(C)=O |
| InChI | InChI=1S/C11H17FO2/c1-7(9(3)13)11-5-4-10(6-14-12)8(11)2/h7,10-11H,2,4-6H2,1,3H3 |
| InChIKey | FYKCHNWLILBHLB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite?
The IUPAC name of [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite (CID 146209464) is [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite.
What is the SMILES notation for [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite?
The canonical SMILES for [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite is C=C1C(COF)CCC1C(C)C(C)=O.
What is the InChIKey of [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite?
The InChIKey is FYKCHNWLILBHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FO2/c1-7(9(3)13)11-5-4-10(6-14-12)8(11)2/h7,10-11H,2,4-6H2,1,3H3.
What are the key properties of [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite?
[2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite has a molecular weight of 200.25 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methylidene-3-(3-oxobutan-2-yl)cyclopentyl]methyl hypofluorite is sourced from PubChem (CID 146209464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).