C64H52F2N4 — CID 146209492
4-[6-[9,9-dimethyl-2,7-bis(N-phenylanilino)acridin-10-yl]-9,9,10,10-tetramethylanthracen-2-yl]-2,6-difluorobenzonitrile (PubChem CID 146209492) has the molecular formula C64H52F2N4 and a molecular weight of 915.14 g/mol. Its IUPAC name is 4-[6-[9,9-dimethyl-2,7-bis(N-phenylanilino)acridin-10-yl]-9,9,10,10-tetramethylanthracen-2-yl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[6-[9,9-dimethyl-2,7-bis(N-phenylanilino)acridin-10-yl]-9,9,10,10-tetramethylanthracen-2-yl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 146209492 |
| Molecular Formula | C64H52F2N4 |
| Molecular Weight | 915.14 g/mol |
| Exact Mass | 914.42 |
| IUPAC Name | 4-[6-[9,9-dimethyl-2,7-bis(N-phenylanilino)acridin-10-yl]-9,9,10,10-tetramethylanthracen-2-yl]-2,6-difluorobenzonitrile |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3ccccc3)ccc2N(c2ccc3c(c2)C(C)(C)c2ccc(-c4cc(F)c(C#N)c(F)c4)cc2C3(C)C)c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C64H52F2N4/c1-62(2)53-32-28-50(38-55(53)63(3,4)52-31-27-42(35-54(52)62)43-36-58(65)51(41-67)59(66)37-43)70-60-33-29-48(68(44-19-11-7-12-20-44)45-21-13-8-14-22-45)39-56(60)64(5,6)57-40-49(30-34-61(57)70)69(46-23-15-9-16-24-46)47-25-17-10-18-26-47/h7-40H,1-6H3 |
| InChIKey | XAZMIGMYDGKOKQ-UHFFFAOYSA-N |
| XLogP | 17.52 |
| TPSA | 33.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.14 |
| LogP ≤ 5 | 17.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |