C59H50N2O3 — CID 146209949
12,18-bis(4-tert-butyl-N-(3-methylphenyl)anilino)-10,26-dioxaheptacyclo[14.11.0.02,14.03,11.04,9.019,27.020,25]heptacosa-1(27),2,4,6,8,11,13,16,18,20,22,24-dodecaen-15-one (PubChem CID 146209949) has the molecular formula C59H50N2O3 and a molecular weight of 835.06 g/mol. Its IUPAC name is 12,18-bis(4-tert-butyl-N-(3-methylphenyl)anilino)-10,26-dioxaheptacyclo[14.11.0.02,14.03,11.04,9.019,27.020,25]heptacosa-1(27),2,4,6,8,11,13,16,18,20,22,24-dodecaen-15-one.
| Compound Name | 12,18-bis(4-tert-butyl-N-(3-methylphenyl)anilino)-10,26-dioxaheptacyclo[14.11.0.02,14.03,11.04,9.019,27.020,25]heptacosa-1(27),2,4,6,8,11,13,16,18,20,22,24-dodecaen-15-one |
|---|---|
| PubChem CID | 146209949 |
| Molecular Formula | C59H50N2O3 |
| Molecular Weight | 835.06 g/mol |
| Exact Mass | 834.38 |
| IUPAC Name | 12,18-bis(4-tert-butyl-N-(3-methylphenyl)anilino)-10,26-dioxaheptacyclo[14.11.0.02,14.03,11.04,9.019,27.020,25]heptacosa-1(27),2,4,6,8,11,13,16,18,20,22,24-dodecaen-15-one |
| SMILES | Cc1cccc(N(c2ccc(C(C)(C)C)cc2)c2cc3c(c4c2oc2ccccc24)-c2c(cc(N(c4ccc(C(C)(C)C)cc4)c4cccc(C)c4)c4c2oc2ccccc24)C3=O)c1 |
| InChI | InChI=1S/C59H50N2O3/c1-35-15-13-17-41(31-35)60(39-27-23-37(24-28-39)58(3,4)5)47-33-46-54(57-51(47)43-19-9-11-21-49(43)64-57)52-45(55(46)62)34-48(56-53(52)44-20-10-12-22-50(44)63-56)61(42-18-14-16-36(2)32-42)40-29-25-38(26-30-40)59(6,7)8/h9-34H,1-8H3 |
| InChIKey | WEHAFMIEYJFLLE-UHFFFAOYSA-N |
| XLogP | 16.85 |
| TPSA | 49.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.06 |
| LogP ≤ 5 | 16.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |