C11H17N3 — CID 146210947
5-methyl-3-[(2E)-4-methylhepta-2,6-dien-3-yl]-1H-1,2,4-triazole (PubChem CID 146210947) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 5-methyl-3-[(2E)-4-methylhepta-2,6-dien-3-yl]-1H-1,2,4-triazole.
| Compound Name | 5-methyl-3-[(2E)-4-methylhepta-2,6-dien-3-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 146210947 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 5-methyl-3-[(2E)-4-methylhepta-2,6-dien-3-yl]-1H-1,2,4-triazole |
| SMILES | C=CCC(C)/C(=C\C)c1n[nH]c(C)n1 |
| InChI | InChI=1S/C11H17N3/c1-5-7-8(3)10(6-2)11-12-9(4)13-14-11/h5-6,8H,1,7H2,2-4H3,(H,12,13,14)/b10-6+ |
| InChIKey | YLRVBFZMWQLBNP-UXBLZVDNSA-N |
| XLogP | 2.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|