About 5-acetyl-2-amino-3,6-dichlorobenzonitrile
5-acetyl-2-amino-3,6-dichlorobenzonitrile (PubChem CID 14621101) has the molecular formula C9H6Cl2N2O
and a molecular weight of 229.07 g/mol. Its IUPAC name is 5-acetyl-2-amino-3,6-dichlorobenzonitrile.
Molecular Properties
| Compound Name | 5-acetyl-2-amino-3,6-dichlorobenzonitrile |
| PubChem CID | 14621101 |
| Molecular Formula | C9H6Cl2N2O |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 5-acetyl-2-amino-3,6-dichlorobenzonitrile |
| SMILES | CC(=O)c1cc(Cl)c(N)c(C#N)c1Cl |
| InChI | InChI=1S/C9H6Cl2N2O/c1-4(14)5-2-7(10)9(13)6(3-12)8(5)11/h2H,13H2,1H3 |
| InChIKey | AKUWXAIXJVZYNK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-2-amino-3,6-dichlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-2-amino-3,6-dichlorobenzonitrile?
The IUPAC name of 5-acetyl-2-amino-3,6-dichlorobenzonitrile (CID 14621101) is 5-acetyl-2-amino-3,6-dichlorobenzonitrile.
What is the SMILES notation for 5-acetyl-2-amino-3,6-dichlorobenzonitrile?
The canonical SMILES for 5-acetyl-2-amino-3,6-dichlorobenzonitrile is CC(=O)c1cc(Cl)c(N)c(C#N)c1Cl.
What is the InChIKey of 5-acetyl-2-amino-3,6-dichlorobenzonitrile?
The InChIKey is AKUWXAIXJVZYNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl2N2O/c1-4(14)5-2-7(10)9(13)6(3-12)8(5)11/h2H,13H2,1H3.
What are the key properties of 5-acetyl-2-amino-3,6-dichlorobenzonitrile?
5-acetyl-2-amino-3,6-dichlorobenzonitrile has a molecular weight of 229.07 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2-amino-3,6-dichlorobenzonitrile is sourced from PubChem (CID 14621101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).