About 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one
8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one (PubChem CID 146212075) has the molecular formula C15H12BrFN2O2
and a molecular weight of 351.18 g/mol. Its IUPAC name is 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one.
Molecular Properties
| Compound Name | 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one |
| PubChem CID | 146212075 |
| Molecular Formula | C15H12BrFN2O2 |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one |
| SMILES | COC1CC2(C1)C(=O)Nc1cnc3cc(F)c(Br)cc3c12 |
| InChI | InChI=1S/C15H12BrFN2O2/c1-21-7-4-15(5-7)13-8-2-9(16)10(17)3-11(8)18-6-12(13)19-14(15)20/h2-3,6-7H,4-5H2,1H3,(H,19,20) |
| InChIKey | OLUGULSZPIJORE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one?
The IUPAC name of 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one (CID 146212075) is 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one.
What is the SMILES notation for 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one?
The canonical SMILES for 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one is COC1CC2(C1)C(=O)Nc1cnc3cc(F)c(Br)cc3c12.
What is the InChIKey of 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one?
The InChIKey is OLUGULSZPIJORE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrFN2O2/c1-21-7-4-15(5-7)13-8-2-9(16)10(17)3-11(8)18-6-12(13)19-14(15)20/h2-3,6-7H,4-5H2,1H3,(H,19,20).
What are the key properties of 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one?
8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one has a molecular weight of 351.18 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-7-fluoro-3'-methoxyspiro[3H-pyrrolo[2,3-c]quinoline-1,1'-cyclobutane]-2-one is sourced from PubChem (CID 146212075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).