About 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine
5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine (PubChem CID 146212346) has the molecular formula C13H18BrF2N3O
and a molecular weight of 350.21 g/mol. Its IUPAC name is 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine.
Molecular Properties
| Compound Name | 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine |
| PubChem CID | 146212346 |
| Molecular Formula | C13H18BrF2N3O |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine |
| SMILES | Nc1cc(Br)cnc1OCCCN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H18BrF2N3O/c14-10-8-11(17)12(18-9-10)20-7-1-4-19-5-2-13(15,16)3-6-19/h8-9H,1-7,17H2 |
| InChIKey | URMVLTJQIOBCLT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine?
The IUPAC name of 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine (CID 146212346) is 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine.
What is the SMILES notation for 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine?
The canonical SMILES for 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine is Nc1cc(Br)cnc1OCCCN1CCC(F)(F)CC1.
What is the InChIKey of 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine?
The InChIKey is URMVLTJQIOBCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrF2N3O/c14-10-8-11(17)12(18-9-10)20-7-1-4-19-5-2-13(15,16)3-6-19/h8-9H,1-7,17H2.
What are the key properties of 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine?
5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine has a molecular weight of 350.21 g/mol, XLogP of 2.93, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[3-(4,4-difluoropiperidin-1-yl)propoxy]pyridin-3-amine is sourced from PubChem (CID 146212346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).