About 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline
3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline (PubChem CID 146212515) has the molecular formula C22H34N2S
and a molecular weight of 358.60 g/mol. Its IUPAC name is 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline |
| PubChem CID | 146212515 |
| Molecular Formula | C22H34N2S |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline |
| SMILES | CC(C)S(c1cccc(N(C)C)c1)(c1cccc(N(C)C)c1)C(C)C |
| InChI | InChI=1S/C22H34N2S/c1-17(2)25(18(3)4,21-13-9-11-19(15-21)23(5)6)22-14-10-12-20(16-22)24(7)8/h9-18H,1-8H3 |
| InChIKey | HRCSZGVIQCGKOG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline?
The IUPAC name of 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline (CID 146212515) is 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline.
What is the SMILES notation for 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline?
The canonical SMILES for 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline is CC(C)S(c1cccc(N(C)C)c1)(c1cccc(N(C)C)c1)C(C)C.
What is the InChIKey of 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline?
The InChIKey is HRCSZGVIQCGKOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34N2S/c1-17(2)25(18(3)4,21-13-9-11-19(15-21)23(5)6)22-14-10-12-20(16-22)24(7)8/h9-18H,1-8H3.
What are the key properties of 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline?
3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline has a molecular weight of 358.60 g/mol, XLogP of 5.86, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(dimethylamino)phenyl]-di(propan-2-yl)-λ4-sulfanyl]-N,N-dimethylaniline is sourced from PubChem (CID 146212515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).