C25H18N4O2 — CID 146213264
(4-ethynylphenyl)-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethoxymethyl)phenyl]methanone (PubChem CID 146213264) has the molecular formula C25H18N4O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is (4-ethynylphenyl)-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethoxymethyl)phenyl]methanone.
| Compound Name | (4-ethynylphenyl)-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 146213264 |
| Molecular Formula | C25H18N4O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (4-ethynylphenyl)-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethoxymethyl)phenyl]methanone |
| SMILES | C#Cc1ccc(C(=O)c2ccc(COCc3nc4c(cnc5[nH]ccc54)[nH]3)cc2)cc1 |
| InChI | InChI=1S/C25H18N4O2/c1-2-16-3-7-18(8-4-16)24(30)19-9-5-17(6-10-19)14-31-15-22-28-21-13-27-25-20(11-12-26-25)23(21)29-22/h1,3-13H,14-15H2,(H,26,27)(H,28,29) |
| InChIKey | DSOWBTHBYZQWAG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|