About (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol
(2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol (PubChem CID 146213471) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol |
| PubChem CID | 146213471 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol |
| SMILES | CC(C)[C@H](CO)C1C=CC=CC1 |
| InChI | InChI=1S/C11H18O/c1-9(2)11(8-12)10-6-4-3-5-7-10/h3-6,9-12H,7-8H2,1-2H3/t10?,11-/m0/s1 |
| InChIKey | POAJTGMXFPPROA-DTIOYNMSSA-N |
| XLogP | 2.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol?
The IUPAC name of (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol (CID 146213471) is (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol.
What is the SMILES notation for (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol?
The canonical SMILES for (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol is CC(C)[C@H](CO)C1C=CC=CC1.
What is the InChIKey of (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol?
The InChIKey is POAJTGMXFPPROA-DTIOYNMSSA-N. The full InChI is InChI=1S/C11H18O/c1-9(2)11(8-12)10-6-4-3-5-7-10/h3-6,9-12H,7-8H2,1-2H3/t10?,11-/m0/s1.
What are the key properties of (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol?
(2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol has a molecular weight of 166.26 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-cyclohexa-2,4-dien-1-yl-3-methylbutan-1-ol is sourced from PubChem (CID 146213471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).