C9H15NO2 — CID 146213869
(1E,3Z,5E)-3-(2-aminoethyl)hepta-1,3,5-triene-1,6-diol (PubChem CID 146213869) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (1E,3Z,5E)-3-(2-aminoethyl)hepta-1,3,5-triene-1,6-diol.
| Compound Name | (1E,3Z,5E)-3-(2-aminoethyl)hepta-1,3,5-triene-1,6-diol |
|---|---|
| PubChem CID | 146213869 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (1E,3Z,5E)-3-(2-aminoethyl)hepta-1,3,5-triene-1,6-diol |
| SMILES | C/C(O)=C\C=C(/C=C/O)CCN |
| InChI | InChI=1S/C9H15NO2/c1-8(12)2-3-9(4-6-10)5-7-11/h2-3,5,7,11-12H,4,6,10H2,1H3/b7-5+,8-2+,9-3- |
| InChIKey | IEEGCRKHYWBOHK-GIURRYIISA-N |
| XLogP | 1.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|