C11H16F3N — CID 146214645
N-[(2Z,4E)-6,6,6-trifluoro-5-methyl-3-propan-2-ylhexa-2,4-dien-2-yl]methanimine (PubChem CID 146214645) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is N-[(2Z,4E)-6,6,6-trifluoro-5-methyl-3-propan-2-ylhexa-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2Z,4E)-6,6,6-trifluoro-5-methyl-3-propan-2-ylhexa-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 146214645 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | N-[(2Z,4E)-6,6,6-trifluoro-5-methyl-3-propan-2-ylhexa-2,4-dien-2-yl]methanimine |
| SMILES | C=N/C(C)=C(\C=C(/C)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H16F3N/c1-7(2)10(9(4)15-5)6-8(3)11(12,13)14/h6-7H,5H2,1-4H3/b8-6+,10-9+ |
| InChIKey | IGMSTXKFHXRPEH-QGHYKFKQSA-N |
| XLogP | 4.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|