C23H32ClN5O2 — CID 146215153
1-[4-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-oxazepan-3-yl]-5-chloro-2-methylphenyl]-4-methylpiperidin-4-ol (PubChem CID 146215153) has the molecular formula C23H32ClN5O2 and a molecular weight of 446.00 g/mol. Its IUPAC name is 1-[4-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-oxazepan-3-yl]-5-chloro-2-methylphenyl]-4-methylpiperidin-4-ol.
| Compound Name | 1-[4-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-oxazepan-3-yl]-5-chloro-2-methylphenyl]-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 146215153 |
| Molecular Formula | C23H32ClN5O2 |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 1-[4-[4-(2-amino-6-methylpyrimidin-4-yl)-1,4-oxazepan-3-yl]-5-chloro-2-methylphenyl]-4-methylpiperidin-4-ol |
| SMILES | Cc1cc(N2CCCOCC2c2cc(C)c(N3CCC(C)(O)CC3)cc2Cl)nc(N)n1 |
| InChI | InChI=1S/C23H32ClN5O2/c1-15-11-17(18(24)13-19(15)28-8-5-23(3,30)6-9-28)20-14-31-10-4-7-29(20)21-12-16(2)26-22(25)27-21/h11-13,20,30H,4-10,14H2,1-3H3,(H2,25,26,27) |
| InChIKey | RIIXSPQROPPGOD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|