C16H14ClF3N4O3 — CID 146215207
(8R)-10-chloro-12-(trifluoromethoxy)-6,14-dioxa-2,16,18-triazatetracyclo[13.3.1.19,13.02,8]icosa-1(19),9(20),10,12,15,17-hexaen-17-amine (PubChem CID 146215207) has the molecular formula C16H14ClF3N4O3 and a molecular weight of 402.76 g/mol. Its IUPAC name is (8R)-10-chloro-12-(trifluoromethoxy)-6,14-dioxa-2,16,18-triazatetracyclo[13.3.1.19,13.02,8]icosa-1(19),9(20),10,12,15,17-hexaen-17-amine.
| Compound Name | (8R)-10-chloro-12-(trifluoromethoxy)-6,14-dioxa-2,16,18-triazatetracyclo[13.3.1.19,13.02,8]icosa-1(19),9(20),10,12,15,17-hexaen-17-amine |
|---|---|
| PubChem CID | 146215207 |
| Molecular Formula | C16H14ClF3N4O3 |
| Molecular Weight | 402.76 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (8R)-10-chloro-12-(trifluoromethoxy)-6,14-dioxa-2,16,18-triazatetracyclo[13.3.1.19,13.02,8]icosa-1(19),9(20),10,12,15,17-hexaen-17-amine |
| SMILES | Nc1nc2cc(n1)N1CCCOC[C@H]1c1cc(c(OC(F)(F)F)cc1Cl)O2 |
| InChI | InChI=1S/C16H14ClF3N4O3/c17-9-5-12(27-16(18,19)20)11-4-8(9)10-7-25-3-1-2-24(10)13-6-14(26-11)23-15(21)22-13/h4-6,10H,1-3,7H2,(H2,21,22,23)/t10-/m0/s1 |
| InChIKey | DPNGTGKVLROEAO-JTQLQIEISA-N |
| XLogP | 3.68 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |