C19H20ClN5O3 — CID 146215519
(8R)-17-amino-10-chloro-N-cyclopropyl-6,14-dioxa-2,16,18-triazatetracyclo[13.3.1.19,13.02,8]icosa-1(19),9(20),10,12,15,17-hexaene-12-carboxamide (PubChem CID 146215519) has the molecular formula C19H20ClN5O3 and a molecular weight of 401.85 g/mol. Its IUPAC name is (8R)-17-amino-10-chloro-N-cyclopropyl-6,14-dioxa-2,16,18-triazatetracyclo[13.3.1.19,13.02,8]icosa-1(19),9(20),10,12,15,17-hexaene-12-carboxamide.
| Compound Name | (8R)-17-amino-10-chloro-N-cyclopropyl-6,14-dioxa-2,16,18-triazatetracyclo[13.3.1.19,13.02,8]icosa-1(19),9(20),10,12,15,17-hexaene-12-carboxamide |
|---|---|
| PubChem CID | 146215519 |
| Molecular Formula | C19H20ClN5O3 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (8R)-17-amino-10-chloro-N-cyclopropyl-6,14-dioxa-2,16,18-triazatetracyclo[13.3.1.19,13.02,8]icosa-1(19),9(20),10,12,15,17-hexaene-12-carboxamide |
| SMILES | Nc1nc2cc(n1)N1CCCOC[C@H]1c1cc(c(C(=O)NC3CC3)cc1Cl)O2 |
| InChI | InChI=1S/C19H20ClN5O3/c20-13-6-12(18(26)22-10-2-3-10)15-7-11(13)14-9-27-5-1-4-25(14)16-8-17(28-15)24-19(21)23-16/h6-8,10,14H,1-5,9H2,(H,22,26)(H2,21,23,24)/t14-/m0/s1 |
| InChIKey | VZVPTRJHBMBSEC-AWEZNQCLSA-N |
| XLogP | 2.68 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |