About 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol
1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol (PubChem CID 14621580) has the molecular formula C12H21ClN4O3
and a molecular weight of 304.78 g/mol. Its IUPAC name is 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol |
| PubChem CID | 14621580 |
| Molecular Formula | C12H21ClN4O3 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol |
| SMILES | CC(C)(Cl)C(C)(C)NCC(O)Cn1ccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H21ClN4O3/c1-11(2,13)12(3,4)15-7-9(18)8-16-6-5-14-10(16)17(19)20/h5-6,9,15,18H,7-8H2,1-4H3 |
| InChIKey | QGMKRJCXNANVBZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol?
The IUPAC name of 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol (CID 14621580) is 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol.
What is the SMILES notation for 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol?
The canonical SMILES for 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol is CC(C)(Cl)C(C)(C)NCC(O)Cn1ccnc1[N+](=O)[O-].
What is the InChIKey of 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol?
The InChIKey is QGMKRJCXNANVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClN4O3/c1-11(2,13)12(3,4)15-7-9(18)8-16-6-5-14-10(16)17(19)20/h5-6,9,15,18H,7-8H2,1-4H3.
What are the key properties of 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol?
1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol has a molecular weight of 304.78 g/mol, XLogP of 1.54, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-chloro-2,3-dimethylbutan-2-yl)amino]-3-(2-nitroimidazol-1-yl)propan-2-ol is sourced from PubChem (CID 14621580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).